ChemNet > CAS > 1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
상품명칭 |
thieno[3,2-b]thiophene-2-carboxylic acid |
분자식 |
C7H4O2S2 |
분자량 |
184.2355 |
InChI |
InChI=1/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9) |
cas번호 |
1723-27-9 |
분자 구조 |
|
밀도 |
1.601g/cm3 |
녹는 점 |
218℃ |
비등점 |
386.7°C at 760 mmHg |
굴절 지수 |
1.769 |
인화점 |
187.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|